C15H17F3N2O3 — CID 5070158
[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-propoxyphenyl)methanone (PubChem CID 5070158) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-propoxyphenyl)methanone.
| Compound Name | [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 5070158 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-propoxyphenyl)methanone |
| SMILES | CCCOc1cccc(C(=O)N2N=C(C)CC2(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O3/c1-3-7-23-12-6-4-5-11(8-12)13(21)20-14(22,15(16,17)18)9-10(2)19-20/h4-6,8,22H,3,7,9H2,1-2H3 |
| InChIKey | MDTACKPUEBRCEB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |