C17H30N6OS — CID 5070656
N-[3-(dimethylamino)propyl]-2-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 5070656) has the molecular formula C17H30N6OS and a molecular weight of 366.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 5070656 |
| Molecular Formula | C17H30N6OS |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | Cc1cc(N2CCN(C)CC2)nc(SCC(=O)NCCCN(C)C)n1 |
| InChI | InChI=1S/C17H30N6OS/c1-14-12-15(23-10-8-22(4)9-11-23)20-17(19-14)25-13-16(24)18-6-5-7-21(2)3/h12H,5-11,13H2,1-4H3,(H,18,24) |
| InChIKey | QEBDDOLKCNNWML-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|