About furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate
furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate (PubChem CID 507320) has the molecular formula C20H16ClNO5
and a molecular weight of 385.80 g/mol. Its IUPAC name is furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate |
| PubChem CID | 507320 |
| Molecular Formula | C20H16ClNO5 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate |
| SMILES | COc1ccccc1C(=O)Nc1ccc(Cl)c(C(=O)OCc2ccco2)c1 |
| InChI | InChI=1S/C20H16ClNO5/c1-25-18-7-3-2-6-15(18)19(23)22-13-8-9-17(21)16(11-13)20(24)27-12-14-5-4-10-26-14/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | FMOAMUMFUGEOFZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate?
The IUPAC name of furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate (CID 507320) is furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate.
What is the SMILES notation for furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate?
The canonical SMILES for furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate is COc1ccccc1C(=O)Nc1ccc(Cl)c(C(=O)OCc2ccco2)c1.
What is the InChIKey of furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate?
The InChIKey is FMOAMUMFUGEOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClNO5/c1-25-18-7-3-2-6-15(18)19(23)22-13-8-9-17(21)16(11-13)20(24)27-12-14-5-4-10-26-14/h2-11H,12H2,1H3,(H,22,23).
What are the key properties of furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate?
furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate has a molecular weight of 385.80 g/mol, XLogP of 4.55, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 2-chloro-5-[(2-methoxybenzoyl)amino]benzoate is sourced from PubChem (CID 507320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).