C23H21N3O4 — CID 50740495
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(3-hydroxy-2-pyridinyl)-3-phenylpropanamide (PubChem CID 50740495) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(3-hydroxy-2-pyridinyl)-3-phenylpropanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(3-hydroxy-2-pyridinyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 50740495 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(3-hydroxy-2-pyridinyl)-3-phenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ncccc1O |
| InChI | InChI=1S/C23H21N3O4/c27-17-7-4-10-24-21(17)25-18(28)12-16(13-5-2-1-3-6-13)26-22(29)19-14-8-9-15(11-14)20(19)23(26)30/h1-10,14-16,19-20,27H,11-12H2,(H,24,25,28) |
| InChIKey | FIKPFQXZCYIMOM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|