C23H20FN3O3 — CID 54774639
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-pyridin-3-ylpropanamide (PubChem CID 54774639) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-pyridin-3-ylpropanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 54774639 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-pyridin-3-ylpropanamide |
| SMILES | O=C(CC(c1cccc(F)c1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1cccnc1 |
| InChI | InChI=1S/C23H20FN3O3/c24-16-4-1-3-13(10-16)18(11-19(28)26-17-5-2-8-25-12-17)27-22(29)20-14-6-7-15(9-14)21(20)23(27)30/h1-8,10,12,14-15,18,20-21H,9,11H2,(H,26,28) |
| InChIKey | NHPXTKIPVKOHHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|