C21H19BrN4O3S — CID 54774637
3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 54774637) has the molecular formula C21H19BrN4O3S and a molecular weight of 487.38 g/mol. Its IUPAC name is 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 54774637 |
| Molecular Formula | C21H19BrN4O3S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | Cc1nnc(NC(=O)CC(c2cccc(Br)c2)N2C(=O)C3C4C=CC(C4)C3C2=O)s1 |
| InChI | InChI=1S/C21H19BrN4O3S/c1-10-24-25-21(30-10)23-16(27)9-15(11-3-2-4-14(22)8-11)26-19(28)17-12-5-6-13(7-12)18(17)20(26)29/h2-6,8,12-13,15,17-18H,7,9H2,1H3,(H,23,25,27) |
| InChIKey | CZUFNTJCFHOCGR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|