C27H22BrN3O3S — CID 54774660
3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)propanamide (PubChem CID 54774660) has the molecular formula C27H22BrN3O3S and a molecular weight of 548.46 g/mol. Its IUPAC name is 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 54774660 |
| Molecular Formula | C27H22BrN3O3S |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 3-(3-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CC(c1cccc(Br)c1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C27H22BrN3O3S/c28-19-8-4-7-16(12-19)21(31-25(33)23-17-9-10-18(11-17)24(23)26(31)34)13-22(32)30-27-29-20(14-35-27)15-5-2-1-3-6-15/h1-10,12,14,17-18,21,23-24H,11,13H2,(H,29,30,32) |
| InChIKey | ZSWTUAANAQWVRJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|