C21H16F4N4O3S — CID 54774695
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 54774695) has the molecular formula C21H16F4N4O3S and a molecular weight of 480.44 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 54774695 |
| Molecular Formula | C21H16F4N4O3S |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | O=C(CC(c1cccc(F)c1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C21H16F4N4O3S/c22-12-3-1-2-9(7-12)13(8-14(30)26-20-28-27-19(33-20)21(23,24)25)29-17(31)15-10-4-5-11(6-10)16(15)18(29)32/h1-5,7,10-11,13,15-16H,6,8H2,(H,26,28,30) |
| InChIKey | ZHRONLFPACDWJN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|