C22H22N4O3S — CID 54774779
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-methylphenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 54774779) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-methylphenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-methylphenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 54774779 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-methylphenyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | Cc1ccc(C(CC(=O)Nc2nnc(C)s2)N2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-11-3-5-13(6-4-11)16(10-17(27)23-22-25-24-12(2)30-22)26-20(28)18-14-7-8-15(9-14)19(18)21(26)29/h3-8,14-16,18-19H,9-10H2,1-2H3,(H,23,25,27) |
| InChIKey | LSGKIGWCTMTITI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|