C24H27FN2O3 — CID 54774711
N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)propanamide (PubChem CID 54774711) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)propanamide.
| Compound Name | N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 54774711 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(3-fluorophenyl)propanamide |
| SMILES | O=C(CC(c1cccc(F)c1)N1C(=O)C2C3C=CC(C3)C2C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H27FN2O3/c25-17-6-4-5-14(12-17)19(13-20(28)26-18-7-2-1-3-8-18)27-23(29)21-15-9-10-16(11-15)22(21)24(27)30/h4-6,9-10,12,15-16,18-19,21-22H,1-3,7-8,11,13H2,(H,26,28) |
| InChIKey | DPGJDTYPLYWMRK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|