C25H30N2O3 — CID 53276634
N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-3-phenylpropanamide (PubChem CID 53276634) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-3-phenylpropanamide.
| Compound Name | N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 53276634 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-cyclohexyl-3-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-3-phenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)N1C(=O)C2C3C=CC(CC3)C2C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H30N2O3/c28-21(26-19-9-5-2-6-10-19)15-20(16-7-3-1-4-8-16)27-24(29)22-17-11-12-18(14-13-17)23(22)25(27)30/h1,3-4,7-8,11-12,17-20,22-23H,2,5-6,9-10,13-15H2,(H,26,28) |
| InChIKey | BJPJEFWAULKKDA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|