C13H18F3NO4 — CID 50742311
tert-butyl 2-(4,4,4-trifluoro-3-oxobutanoyl)pyrrolidine-1-carboxylate (PubChem CID 50742311) has the molecular formula C13H18F3NO4 and a molecular weight of 309.28 g/mol. Its IUPAC name is tert-butyl 2-(4,4,4-trifluoro-3-oxobutanoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4,4,4-trifluoro-3-oxobutanoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 50742311 |
| Molecular Formula | C13H18F3NO4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | tert-butyl 2-(4,4,4-trifluoro-3-oxobutanoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO4/c1-12(2,3)21-11(20)17-6-4-5-8(17)9(18)7-10(19)13(14,15)16/h8H,4-7H2,1-3H3 |
| InChIKey | LMHCUUOPKFEGRC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|