C15H14N2S — CID 50742560
1-[(2-methylphenyl)methyl]-5H-pyrrolo[3,2-c]pyridine-4-thione (PubChem CID 50742560) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-5H-pyrrolo[3,2-c]pyridine-4-thione.
| Compound Name | 1-[(2-methylphenyl)methyl]-5H-pyrrolo[3,2-c]pyridine-4-thione |
|---|---|
| PubChem CID | 50742560 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-5H-pyrrolo[3,2-c]pyridine-4-thione |
| SMILES | Cc1ccccc1Cn1ccc2c(=S)[nH]ccc21 |
| InChI | InChI=1S/C15H14N2S/c1-11-4-2-3-5-12(11)10-17-9-7-13-14(17)6-8-16-15(13)18/h2-9H,10H2,1H3,(H,16,18) |
| InChIKey | HAHSYMNSUHFLJX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|