C15H19N — CID 63926468
2,3,4-trimethyl-1-[(2-methylphenyl)methyl]pyrrole (PubChem CID 63926468) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3,4-trimethyl-1-[(2-methylphenyl)methyl]pyrrole.
| Compound Name | 2,3,4-trimethyl-1-[(2-methylphenyl)methyl]pyrrole |
|---|---|
| PubChem CID | 63926468 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,3,4-trimethyl-1-[(2-methylphenyl)methyl]pyrrole |
| SMILES | Cc1ccccc1Cn1cc(C)c(C)c1C |
| InChI | InChI=1S/C15H19N/c1-11-7-5-6-8-15(11)10-16-9-12(2)13(3)14(16)4/h5-9H,10H2,1-4H3 |
| InChIKey | SJLVYWJVYLKRQV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |