C10H10ClN3 — CID 63385384
3-chloro-4-[(2-methylphenyl)methyl]-1,2,4-triazole (PubChem CID 63385384) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-chloro-4-[(2-methylphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-chloro-4-[(2-methylphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 63385384 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-chloro-4-[(2-methylphenyl)methyl]-1,2,4-triazole |
| SMILES | Cc1ccccc1Cn1cnnc1Cl |
| InChI | InChI=1S/C10H10ClN3/c1-8-4-2-3-5-9(8)6-14-7-12-13-10(14)11/h2-5,7H,6H2,1H3 |
| InChIKey | IOCDIVLVAXTKJG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |