C10H10ClN3O — CID 63383373
3-chloro-4-[(2-methoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 63383373) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 3-chloro-4-[(2-methoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-chloro-4-[(2-methoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 63383373 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-chloro-4-[(2-methoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | COc1ccccc1Cn1cnnc1Cl |
| InChI | InChI=1S/C10H10ClN3O/c1-15-9-5-3-2-4-8(9)6-14-7-12-13-10(14)11/h2-5,7H,6H2,1H3 |
| InChIKey | XUWHYYDVNNJJMX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |