C10H10IN3O — CID 79785195
3-iodo-1-[(2-methoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 79785195) has the molecular formula C10H10IN3O and a molecular weight of 315.11 g/mol. Its IUPAC name is 3-iodo-1-[(2-methoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-iodo-1-[(2-methoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 79785195 |
| Molecular Formula | C10H10IN3O |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 3-iodo-1-[(2-methoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | COc1ccccc1Cn1cnc(I)n1 |
| InChI | InChI=1S/C10H10IN3O/c1-15-9-5-3-2-4-8(9)6-14-7-12-10(11)13-14/h2-5,7H,6H2,1H3 |
| InChIKey | JPCGFUPHXLOGAD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|