C13H12N2O3S3 — CID 50744070
N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)thiophene-2-sulfonamide (PubChem CID 50744070) has the molecular formula C13H12N2O3S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50744070 |
| Molecular Formula | C13H12N2O3S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)thiophene-2-sulfonamide |
| SMILES | CCn1c(=O)sc2cc(NS(=O)(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C13H12N2O3S3/c1-2-15-10-6-5-9(8-11(10)20-13(15)16)14-21(17,18)12-4-3-7-19-12/h3-8,14H,2H2,1H3 |
| InChIKey | JWVBONGMRPANIL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |