C22H18N4O — CID 50745567
1-(2-methylphenyl)-N,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 50745567) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2-methylphenyl)-N,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 50745567 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(2-methylphenyl)-N,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccccc1-n1nc(C(=O)Nc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N4O/c1-16-10-8-9-15-19(16)26-21(17-11-4-2-5-12-17)24-20(25-26)22(27)23-18-13-6-3-7-14-18/h2-15H,1H3,(H,23,27) |
| InChIKey | GMLVNGBVFZBQBF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |