About 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide
4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 50747527) has the molecular formula C18H20N4O4S
and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| PubChem CID | 50747527 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cccnc2)cc1-c1nc(CC)no1 |
| InChI | InChI=1S/C18H20N4O4S/c1-3-17-21-18(26-22-17)15-10-14(7-8-16(15)25-4-2)27(23,24)20-12-13-6-5-9-19-11-13/h5-11,20H,3-4,12H2,1-2H3 |
| InChIKey | OKYGACKUXHQNDD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide?
The IUPAC name of 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide (CID 50747527) is 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide?
The canonical SMILES for 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide is CCOc1ccc(S(=O)(=O)NCc2cccnc2)cc1-c1nc(CC)no1.
What is the InChIKey of 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide?
The InChIKey is OKYGACKUXHQNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O4S/c1-3-17-21-18(26-22-17)15-10-14(7-8-16(15)25-4-2)27(23,24)20-12-13-6-5-9-19-11-13/h5-11,20H,3-4,12H2,1-2H3.
What are the key properties of 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide?
4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide has a molecular weight of 388.45 g/mol, XLogP of 2.57, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 50747527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).