C23H21F3N4O5 — CID 507478
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[7-hydroxy-4-(2,2,2-trifluoroethoxy)pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 507478) has the molecular formula C23H21F3N4O5 and a molecular weight of 490.44 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[7-hydroxy-4-(2,2,2-trifluoroethoxy)pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[7-hydroxy-4-(2,2,2-trifluoroethoxy)pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507478 |
| Molecular Formula | C23H21F3N4O5 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[7-hydroxy-4-(2,2,2-trifluoroethoxy)pyrrolo[2,3-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1cnc2n(O)ccc(OCC(F)(F)F)c1-2 |
| InChI | InChI=1S/C23H21F3N4O5/c1-14-12-28(21(32)15-5-3-2-4-6-15)9-10-29(14)22(33)19(31)16-11-27-20-18(16)17(7-8-30(20)34)35-13-23(24,25)26/h2-8,11,14,34H,9-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | ZSJVQKODMWGLMQ-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|