C22H22N4O5 — CID 507754
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-hydroxy-4-methoxypyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione (PubChem CID 507754) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-hydroxy-4-methoxypyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-hydroxy-4-methoxypyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 507754 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-hydroxy-4-methoxypyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione |
| SMILES | COc1ccn(O)c2ncc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C)c1-2 |
| InChI | InChI=1S/C22H22N4O5/c1-14-13-24(21(28)15-6-4-3-5-7-15)10-11-25(14)22(29)19(27)16-12-23-20-18(16)17(31-2)8-9-26(20)30/h3-9,12,14,30H,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | XBLGORRZVZVTQF-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|