C27H30N2O6S — CID 5075578
[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 5075578) has the molecular formula C27H30N2O6S and a molecular weight of 510.61 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 5075578 |
| Molecular Formula | C27H30N2O6S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COC(=O)c2ccccc2OCc2ccccc2)ccc1C |
| InChI | InChI=1S/C27H30N2O6S/c1-4-29(5-2)36(32,33)25-17-22(16-15-20(25)3)28-26(30)19-35-27(31)23-13-9-10-14-24(23)34-18-21-11-7-6-8-12-21/h6-17H,4-5,18-19H2,1-3H3,(H,28,30) |
| InChIKey | HMFWJONMHPCBRK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |