C20H24ClN3O5S — CID 3588142
[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 3588142) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 3588142 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COC(=O)c2ccc(Cl)cc2N)ccc1C |
| InChI | InChI=1S/C20H24ClN3O5S/c1-4-24(5-2)30(27,28)18-11-15(8-6-13(18)3)23-19(25)12-29-20(26)16-9-7-14(21)10-17(16)22/h6-11H,4-5,12,22H2,1-3H3,(H,23,25) |
| InChIKey | WATZZSBPUXXYEM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|