C19H16N4O5 — CID 50755881
3-(1,3-dioxoisoindol-2-yl)-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]butanamide (PubChem CID 50755881) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]butanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 50755881 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]butanamide |
| SMILES | CC(CC(=O)NCc1noc(-c2ccco2)n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N4O5/c1-11(23-18(25)12-5-2-3-6-13(12)19(23)26)9-16(24)20-10-15-21-17(28-22-15)14-7-4-8-27-14/h2-8,11H,9-10H2,1H3,(H,20,24) |
| InChIKey | CWOASRIRAPGYMG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|