C16H18F3N3O3 — CID 50761211
2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 50761211) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 50761211 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C16H18F3N3O3/c1-9-6-11-12(7-10(9)2)22(8-13(23)20-4-5-25-3)15(24)14(21-11)16(17,18)19/h6-7H,4-5,8H2,1-3H3,(H,20,23) |
| InChIKey | GLXFPVHLHHHNAC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|