C17H25N3O2 — CID 17028528
N-(3-ethoxypropyl)-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide (PubChem CID 17028528) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 17028528 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-(3-ethoxypropyl)-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide |
| SMILES | CCOCCCNC(=O)Cn1c(C)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H25N3O2/c1-5-22-8-6-7-18-17(21)11-20-14(4)19-15-9-12(2)13(3)10-16(15)20/h9-10H,5-8,11H2,1-4H3,(H,18,21) |
| InChIKey | WAYMTWPNJQPDEZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|