C24H36N4O5S — CID 50764533
N-[3-(azepan-1-yl)propyl]-1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-3-carboxamide (PubChem CID 50764533) has the molecular formula C24H36N4O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50764533 |
| Molecular Formula | C24H36N4O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-3-carboxamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCCC(C(=O)NCCCN3CCCCCC3)C1)OCC(=O)N2 |
| InChI | InChI=1S/C24H36N4O5S/c1-18-14-20-21(33-17-23(29)26-20)15-22(18)34(31,32)28-13-6-8-19(16-28)24(30)25-9-7-12-27-10-4-2-3-5-11-27/h14-15,19H,2-13,16-17H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | DEQXLPAVVKGCCM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|