C24H36N4O5S — CID 92865820
1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 92865820) has the molecular formula C24H36N4O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92865820 |
| Molecular Formula | C24H36N4O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCC(C(=O)NCCCN3CCC[C@@H](C)C3)CC1)OCC(=O)N2 |
| InChI | InChI=1S/C24H36N4O5S/c1-17-5-3-9-27(15-17)10-4-8-25-24(30)19-6-11-28(12-7-19)34(31,32)22-14-21-20(13-18(22)2)26-23(29)16-33-21/h13-14,17,19H,3-12,15-16H2,1-2H3,(H,25,30)(H,26,29)/t17-/m1/s1 |
| InChIKey | BDYWRIBOMMVVHZ-QGZVFWFLSA-N |
| XLogP | 1.96 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|