C20H28ClN3O5S — CID 92686801
3-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]propanamide (PubChem CID 92686801) has the molecular formula C20H28ClN3O5S and a molecular weight of 457.98 g/mol. Its IUPAC name is 3-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]propanamide.
| Compound Name | 3-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 92686801 |
| Molecular Formula | C20H28ClN3O5S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]propanamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)CCS(=O)(=O)c2cc3c(cc2Cl)NC(=O)CO3)C1 |
| InChI | InChI=1S/C20H28ClN3O5S/c1-14-4-2-7-24(12-14)8-3-6-22-19(25)5-9-30(27,28)18-11-17-16(10-15(18)21)23-20(26)13-29-17/h10-11,14H,2-9,12-13H2,1H3,(H,22,25)(H,23,26)/t14-/m1/s1 |
| InChIKey | CNFPZPOINDCPMH-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|