C26H33N3O4S — CID 50767600
2-(3,3-dimethyl-2-oxo-5-piperidin-1-ylsulfonylindol-1-yl)-N-(2-phenylpropyl)acetamide (PubChem CID 50767600) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxo-5-piperidin-1-ylsulfonylindol-1-yl)-N-(2-phenylpropyl)acetamide.
| Compound Name | 2-(3,3-dimethyl-2-oxo-5-piperidin-1-ylsulfonylindol-1-yl)-N-(2-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 50767600 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxo-5-piperidin-1-ylsulfonylindol-1-yl)-N-(2-phenylpropyl)acetamide |
| SMILES | CC(CNC(=O)CN1C(=O)C(C)(C)c2cc(S(=O)(=O)N3CCCCC3)ccc21)c1ccccc1 |
| InChI | InChI=1S/C26H33N3O4S/c1-19(20-10-6-4-7-11-20)17-27-24(30)18-29-23-13-12-21(16-22(23)26(2,3)25(29)31)34(32,33)28-14-8-5-9-15-28/h4,6-7,10-13,16,19H,5,8-9,14-15,17-18H2,1-3H3,(H,27,30) |
| InChIKey | JXVDAKFDDSZUMX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |