C23H27N3O2 — CID 50768186
N-(4-phenylbutan-2-yl)-2-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)acetamide (PubChem CID 50768186) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)-2-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-(4-phenylbutan-2-yl)-2-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 50768186 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(4-phenylbutan-2-yl)-2-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)acetamide |
| SMILES | Cc1cc2nc(C)c(=O)n(CC(=O)NC(C)CCc3ccccc3)c2cc1C |
| InChI | InChI=1S/C23H27N3O2/c1-15-12-20-21(13-16(15)2)26(23(28)18(4)25-20)14-22(27)24-17(3)10-11-19-8-6-5-7-9-19/h5-9,12-13,17H,10-11,14H2,1-4H3,(H,24,27) |
| InChIKey | BKRUQYXIRZXZPT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |