C21H21N3O2S2 — CID 50770766
5-butyl-4-[(3-methoxyphenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 50770766) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-butyl-4-[(3-methoxyphenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-butyl-4-[(3-methoxyphenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 50770766 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-butyl-4-[(3-methoxyphenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | CCCCn1c(SCc2cccc(OC)c2)nc2c(sc3ncccc32)c1=O |
| InChI | InChI=1S/C21H21N3O2S2/c1-3-4-11-24-20(25)18-17(16-9-6-10-22-19(16)28-18)23-21(24)27-13-14-7-5-8-15(12-14)26-2/h5-10,12H,3-4,11,13H2,1-2H3 |
| InChIKey | AAPMVFJMGPNZFO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |