C25H20ClN3OS2 — CID 94071501
4-[(3-chlorophenyl)methylsulfanyl]-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 94071501) has the molecular formula C25H20ClN3OS2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methylsulfanyl]-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-[(3-chlorophenyl)methylsulfanyl]-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 94071501 |
| Molecular Formula | C25H20ClN3OS2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 4-[(3-chlorophenyl)methylsulfanyl]-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | C[C@H](Cn1c(SCc2cccc(Cl)c2)nc2c(sc3ncccc32)c1=O)c1ccccc1 |
| InChI | InChI=1S/C25H20ClN3OS2/c1-16(18-8-3-2-4-9-18)14-29-24(30)22-21(20-11-6-12-27-23(20)32-22)28-25(29)31-15-17-7-5-10-19(26)13-17/h2-13,16H,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | FSYZPJRWCRRLLN-MRXNPFEDSA-N |
| XLogP | 6.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |