C26H21N3O2S2 — CID 94071609
4-phenacylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 94071609) has the molecular formula C26H21N3O2S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 4-phenacylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-phenacylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 94071609 |
| Molecular Formula | C26H21N3O2S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-phenacylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | C[C@H](Cn1c(SCC(=O)c2ccccc2)nc2c(sc3ncccc32)c1=O)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O2S2/c1-17(18-9-4-2-5-10-18)15-29-25(31)23-22(20-13-8-14-27-24(20)33-23)28-26(29)32-16-21(30)19-11-6-3-7-12-19/h2-14,17H,15-16H2,1H3/t17-/m1/s1 |
| InChIKey | MHVOPXJTRBWOPS-QGZVFWFLSA-N |
| XLogP | 5.78 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |