C22H23N3OS2 — CID 94071518
4-butylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 94071518) has the molecular formula C22H23N3OS2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 4-butylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-butylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 94071518 |
| Molecular Formula | C22H23N3OS2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-butylsulfanyl-5-[(2S)-2-phenylpropyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | CCCCSc1nc2c(sc3ncccc32)c(=O)n1C[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H23N3OS2/c1-3-4-13-27-22-24-18-17-11-8-12-23-20(17)28-19(18)21(26)25(22)14-15(2)16-9-6-5-7-10-16/h5-12,15H,3-4,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | QOUWTEZICWNOMO-OAHLLOKOSA-N |
| XLogP | 5.70 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|