C23H20N4OS2 — CID 50770773
8-benzyl-12-[(2,5-dimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 50770773) has the molecular formula C23H20N4OS2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 8-benzyl-12-[(2,5-dimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-benzyl-12-[(2,5-dimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 50770773 |
| Molecular Formula | C23H20N4OS2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 8-benzyl-12-[(2,5-dimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | Cc1ccc(C)c(CSc2nnc3n(Cc4ccccc4)c(=O)c4sccc4n23)c1 |
| InChI | InChI=1S/C23H20N4OS2/c1-15-8-9-16(2)18(12-15)14-30-23-25-24-22-26(13-17-6-4-3-5-7-17)21(28)20-19(27(22)23)10-11-29-20/h3-12H,13-14H2,1-2H3 |
| InChIKey | LDOJIQGFIUIIJC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |