C24H22N4OS2 — CID 93071924
12-[(3-methylphenyl)methylsulfanyl]-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 93071924) has the molecular formula C24H22N4OS2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 12-[(3-methylphenyl)methylsulfanyl]-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[(3-methylphenyl)methylsulfanyl]-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 93071924 |
| Molecular Formula | C24H22N4OS2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 12-[(3-methylphenyl)methylsulfanyl]-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | Cc1cccc(CSc2nnc3n(C[C@@H](C)c4ccccc4)c(=O)c4sccc4n23)c1 |
| InChI | InChI=1S/C24H22N4OS2/c1-16-7-6-8-18(13-16)15-31-24-26-25-23-27(14-17(2)19-9-4-3-5-10-19)22(29)21-20(28(23)24)11-12-30-21/h3-13,17H,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | HZEBEHLPYBZQKZ-QGZVFWFLSA-N |
| XLogP | 5.51 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |