C17H16N4OS2 — CID 94071625
12-methylsulfanyl-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 94071625) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 12-methylsulfanyl-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-methylsulfanyl-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 94071625 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 12-methylsulfanyl-8-[(2S)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CSc1nnc2n(C[C@@H](C)c3ccccc3)c(=O)c3sccc3n12 |
| InChI | InChI=1S/C17H16N4OS2/c1-11(12-6-4-3-5-7-12)10-20-15(22)14-13(8-9-24-14)21-16(20)18-19-17(21)23-2/h3-9,11H,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | NGWDDSUDTAKTHG-LLVKDONJSA-N |
| XLogP | 3.63 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |