C12H14N4OS2 — CID 50770743
8-butyl-12-methylsulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 50770743) has the molecular formula C12H14N4OS2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 8-butyl-12-methylsulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-butyl-12-methylsulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 50770743 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 8-butyl-12-methylsulfanyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CCCCn1c(=O)c2sccc2n2c(SC)nnc12 |
| InChI | InChI=1S/C12H14N4OS2/c1-3-4-6-15-10(17)9-8(5-7-19-9)16-11(15)13-14-12(16)18-2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | ZFWDLVMIYLPXNC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |