C19H17F2N5O2S2 — CID 50785784
2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2,5-difluorophenyl)acetamide (PubChem CID 50785784) has the molecular formula C19H17F2N5O2S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 50785784 |
| Molecular Formula | C19H17F2N5O2S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2,5-difluorophenyl)acetamide |
| SMILES | CCCCn1c(=O)c2sccc2n2c(SCC(=O)Nc3cc(F)ccc3F)nnc12 |
| InChI | InChI=1S/C19H17F2N5O2S2/c1-2-3-7-25-17(28)16-14(6-8-29-16)26-18(25)23-24-19(26)30-10-15(27)22-13-9-11(20)4-5-12(13)21/h4-6,8-9H,2-3,7,10H2,1H3,(H,22,27) |
| InChIKey | VCOGKWLVSYCAAL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |