C21H24N4OS2 — CID 50743139
8-butyl-12-[(2,4,6-trimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 50743139) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 8-butyl-12-[(2,4,6-trimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-butyl-12-[(2,4,6-trimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 50743139 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 8-butyl-12-[(2,4,6-trimethylphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CCCCn1c(=O)c2sccc2n2c(SCc3c(C)cc(C)cc3C)nnc12 |
| InChI | InChI=1S/C21H24N4OS2/c1-5-6-8-24-19(26)18-17(7-9-27-18)25-20(24)22-23-21(25)28-12-16-14(3)10-13(2)11-15(16)4/h7,9-11H,5-6,8,12H2,1-4H3 |
| InChIKey | DZXPFOYKKPOCLS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |