C19H18ClN5O2S2 — CID 50785865
2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2-chlorophenyl)acetamide (PubChem CID 50785865) has the molecular formula C19H18ClN5O2S2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 50785865 |
| Molecular Formula | C19H18ClN5O2S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)sulfanyl]-N-(2-chlorophenyl)acetamide |
| SMILES | CCCCn1c(=O)c2sccc2n2c(SCC(=O)Nc3ccccc3Cl)nnc12 |
| InChI | InChI=1S/C19H18ClN5O2S2/c1-2-3-9-24-17(27)16-14(8-10-28-16)25-18(24)22-23-19(25)29-11-15(26)21-13-7-5-4-6-12(13)20/h4-8,10H,2-3,9,11H2,1H3,(H,21,26) |
| InChIKey | OURZNOFPKWFUAR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |