C23H19ClN4OS2 — CID 93071917
12-[(4-chlorophenyl)methylsulfanyl]-8-[(2R)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 93071917) has the molecular formula C23H19ClN4OS2 and a molecular weight of 467.02 g/mol. Its IUPAC name is 12-[(4-chlorophenyl)methylsulfanyl]-8-[(2R)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[(4-chlorophenyl)methylsulfanyl]-8-[(2R)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 93071917 |
| Molecular Formula | C23H19ClN4OS2 |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 12-[(4-chlorophenyl)methylsulfanyl]-8-[(2R)-2-phenylpropyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | C[C@@H](Cn1c(=O)c2sccc2n2c(SCc3ccc(Cl)cc3)nnc12)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4OS2/c1-15(17-5-3-2-4-6-17)13-27-21(29)20-19(11-12-30-20)28-22(27)25-26-23(28)31-14-16-7-9-18(24)10-8-16/h2-12,15H,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | FEORRMLYISBDQA-HNNXBMFYSA-N |
| XLogP | 5.86 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |