C24H16F2N4O2S2 — CID 50771031
2-[(5-benzyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-4-yl)sulfanyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 50771031) has the molecular formula C24H16F2N4O2S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[(5-benzyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-4-yl)sulfanyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[(5-benzyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-4-yl)sulfanyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 50771031 |
| Molecular Formula | C24H16F2N4O2S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 2-[(5-benzyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-4-yl)sulfanyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(CSc1nc2c(sc3ncccc32)c(=O)n1Cc1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C24H16F2N4O2S2/c25-15-8-9-18(17(26)11-15)28-19(31)13-33-24-29-20-16-7-4-10-27-22(16)34-21(20)23(32)30(24)12-14-5-2-1-3-6-14/h1-11H,12-13H2,(H,28,31) |
| InChIKey | FAKUSRNMSBWIJJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |