C23H15ClFN3OS2 — CID 50769885
5-benzyl-4-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 50769885) has the molecular formula C23H15ClFN3OS2 and a molecular weight of 467.98 g/mol. Its IUPAC name is 5-benzyl-4-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-benzyl-4-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 50769885 |
| Molecular Formula | C23H15ClFN3OS2 |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 5-benzyl-4-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1c2sc3ncccc3c2nc(SCc2ccc(F)cc2Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H15ClFN3OS2/c24-18-11-16(25)9-8-15(18)13-30-23-27-19-17-7-4-10-26-21(17)31-20(19)22(29)28(23)12-14-5-2-1-3-6-14/h1-11H,12-13H2 |
| InChIKey | FEDXYYRRPLSFFT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |