C22H21ClN4O — CID 50773335
2-chloro-N-[N-(3,4-dimethylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50773335) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-chloro-N-[N-(3,4-dimethylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 2-chloro-N-[N-(3,4-dimethylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50773335 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-chloro-N-[N-(3,4-dimethylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N/Cc2ccncc2)NC(=O)c2ccccc2Cl)cc1C |
| InChI | InChI=1S/C22H21ClN4O/c1-15-7-8-18(13-16(15)2)26-22(25-14-17-9-11-24-12-10-17)27-21(28)19-5-3-4-6-20(19)23/h3-13H,14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | VVEPSWJMLWUKLU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|