C17H13FN2O2S — CID 50773647
2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 50773647) has the molecular formula C17H13FN2O2S and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 50773647 |
| Molecular Formula | C17H13FN2O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | O=C(CSc1ncc(-c2ccc(F)cc2)o1)Nc1ccccc1 |
| InChI | InChI=1S/C17H13FN2O2S/c18-13-8-6-12(7-9-13)15-10-19-17(22-15)23-11-16(21)20-14-4-2-1-3-5-14/h1-10H,11H2,(H,20,21) |
| InChIKey | YEUKNSPCUXEZDB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |