C21H17FN4O4S — CID 46692840
2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 46692840) has the molecular formula C21H17FN4O4S and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 46692840 |
| Molecular Formula | C21H17FN4O4S |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(NC(=O)CSc2ncc(-c3ccc(F)cc3)o2)C1=O |
| InChI | InChI=1S/C21H17FN4O4S/c1-21(14-5-3-2-4-6-14)18(28)26(19(29)24-21)25-17(27)12-31-20-23-11-16(30-20)13-7-9-15(22)10-8-13/h2-11H,12H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | YDMMTKGUDIBLFQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|