C18H22N2O5S2 — CID 50777538
N-(2,5-dimethoxyphenyl)-4-(piperidine-1-carbonyl)thiophene-2-sulfonamide (PubChem CID 50777538) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-(piperidine-1-carbonyl)thiophene-2-sulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-(piperidine-1-carbonyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50777538 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-(piperidine-1-carbonyl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cc(C(=O)N3CCCCC3)cs2)c1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-24-14-6-7-16(25-2)15(11-14)19-27(22,23)17-10-13(12-26-17)18(21)20-8-4-3-5-9-20/h6-7,10-12,19H,3-5,8-9H2,1-2H3 |
| InChIKey | GZOSXARHPNCGKB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |